C10H12N3NaO3S2 — CID 23711539
sodium (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(thian-4-yloxyimino)acetate (PubChem CID 23711539) has the molecular formula C10H12N3NaO3S2 and a molecular weight of 309.35 g/mol. Its IUPAC name is sodium (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(thian-4-yloxyimino)acetate.
| Compound Name | sodium (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(thian-4-yloxyimino)acetate |
|---|---|
| PubChem CID | 23711539 |
| Molecular Formula | C10H12N3NaO3S2 |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | sodium (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(thian-4-yloxyimino)acetate |
| SMILES | Nc1nc(/C(=N/OC2CCSCC2)C(=O)[O-])cs1.[Na+] |
| InChI | InChI=1S/C10H13N3O3S2.Na/c11-10-12-7(5-18-10)8(9(14)15)13-16-6-1-3-17-4-2-6;/h5-6H,1-4H2,(H2,11,12)(H,14,15);/q;+1/p-1/b13-8-; |
| InChIKey | NPOQVBJFSODUQU-MGAWDJABSA-M |
| XLogP | -2.90 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | -2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|