C12H14N3NaO3S — CID 23711522
sodium (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(4-methylidenecyclohexyl)oxyiminoacetate (PubChem CID 23711522) has the molecular formula C12H14N3NaO3S and a molecular weight of 303.32 g/mol. Its IUPAC name is sodium (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(4-methylidenecyclohexyl)oxyiminoacetate.
| Compound Name | sodium (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(4-methylidenecyclohexyl)oxyiminoacetate |
|---|---|
| PubChem CID | 23711522 |
| Molecular Formula | C12H14N3NaO3S |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | sodium (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(4-methylidenecyclohexyl)oxyiminoacetate |
| SMILES | C=C1CCC(O/N=C(\C(=O)[O-])c2csc(N)n2)CC1.[Na+] |
| InChI | InChI=1S/C12H15N3O3S.Na/c1-7-2-4-8(5-3-7)18-15-10(11(16)17)9-6-19-12(13)14-9;/h6,8H,1-5H2,(H2,13,14)(H,16,17);/q;+1/p-1/b15-10-; |
| InChIKey | WVPYRBCUCZJZMD-AZJSCORLSA-M |
| XLogP | -2.30 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|