C19H22N5NaO6S2 — CID 88627195
sodium (2S,5R,6S)-6-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(4-oxocyclohexyl)oxyiminoacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 88627195) has the molecular formula C19H22N5NaO6S2 and a molecular weight of 503.54 g/mol. Its IUPAC name is sodium (2S,5R,6S)-6-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(4-oxocyclohexyl)oxyiminoacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | sodium (2S,5R,6S)-6-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(4-oxocyclohexyl)oxyiminoacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 88627195 |
| Molecular Formula | C19H22N5NaO6S2 |
| Molecular Weight | 503.54 g/mol |
| Exact Mass | 503.09 |
| IUPAC Name | sodium (2S,5R,6S)-6-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(4-oxocyclohexyl)oxyiminoacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC1(C)S[C@@H]2[C@@H](NC(=O)/C(=N\OC3CCC(=O)CC3)c3csc(N)n3)C(=O)N2[C@H]1C(=O)[O-].[Na+] |
| InChI | InChI=1S/C19H23N5O6S2.Na/c1-19(2)13(17(28)29)24-15(27)12(16(24)32-19)22-14(26)11(10-7-31-18(20)21-10)23-30-9-5-3-8(25)4-6-9;/h7,9,12-13,16H,3-6H2,1-2H3,(H2,20,21)(H,22,26)(H,28,29);/q;+1/p-1/b23-11-;/t12-,13-,16+;/m0./s1 |
| InChIKey | QDQQKCKZNQNWPJ-RJAZFSDGSA-M |
| XLogP | -3.74 |
| TPSA | 167.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.54 |
| LogP ≤ 5 | -3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|