C22H30N6O6S2 — CID 88627228
(2S,5R,6S)-6-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[4-(dimethylcarbamoyl)cyclohexyl]oxyiminoacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 88627228) has the molecular formula C22H30N6O6S2 and a molecular weight of 538.65 g/mol. Its IUPAC name is (2S,5R,6S)-6-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[4-(dimethylcarbamoyl)cyclohexyl]oxyiminoacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,5R,6S)-6-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[4-(dimethylcarbamoyl)cyclohexyl]oxyiminoacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 88627228 |
| Molecular Formula | C22H30N6O6S2 |
| Molecular Weight | 538.65 g/mol |
| Exact Mass | 538.17 |
| IUPAC Name | (2S,5R,6S)-6-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[4-(dimethylcarbamoyl)cyclohexyl]oxyiminoacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CN(C)C(=O)C1CCC(O/N=C(\C(=O)N[C@H]2C(=O)N3[C@@H]2SC(C)(C)[C@@H]3C(=O)O)c2csc(N)n2)CC1 |
| InChI | InChI=1S/C22H30N6O6S2/c1-22(2)15(20(32)33)28-18(31)14(19(28)36-22)25-16(29)13(12-9-35-21(23)24-12)26-34-11-7-5-10(6-8-11)17(30)27(3)4/h9-11,14-15,19H,5-8H2,1-4H3,(H2,23,24)(H,25,29)(H,32,33)/b26-13-/t10?,11?,14-,15-,19+/m0/s1 |
| InChIKey | YYHVKIBVKULJJG-WPVLLZSMSA-N |
| XLogP | 0.72 |
| TPSA | 167.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.65 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|