C18H21N6NaO7S2 — CID 88627235
sodium (2S,5R,6R)-6-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[(3S,5S)-5-carboxypyrrolidin-3-yl]oxyiminoacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 88627235) has the molecular formula C18H21N6NaO7S2 and a molecular weight of 520.53 g/mol. Its IUPAC name is sodium (2S,5R,6R)-6-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[(3S,5S)-5-carboxypyrrolidin-3-yl]oxyiminoacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | sodium (2S,5R,6R)-6-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[(3S,5S)-5-carboxypyrrolidin-3-yl]oxyiminoacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 88627235 |
| Molecular Formula | C18H21N6NaO7S2 |
| Molecular Weight | 520.53 g/mol |
| Exact Mass | 520.08 |
| IUPAC Name | sodium (2S,5R,6R)-6-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[(3S,5S)-5-carboxypyrrolidin-3-yl]oxyiminoacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC1(C)S[C@@H]2[C@H](NC(=O)/C(=N\O[C@@H]3CN[C@H](C(=O)O)C3)c3csc(N)n3)C(=O)N2[C@H]1C(=O)[O-].[Na+] |
| InChI | InChI=1S/C18H22N6O7S2.Na/c1-18(2)11(16(29)30)24-13(26)10(14(24)33-18)22-12(25)9(8-5-32-17(19)21-8)23-31-6-3-7(15(27)28)20-4-6;/h5-7,10-11,14,20H,3-4H2,1-2H3,(H2,19,21)(H,22,25)(H,27,28)(H,29,30);/q;+1/p-1/b23-9-;/t6-,7-,10+,11-,14+;/m0./s1 |
| InChIKey | JXSJDKVFIACYLI-SJTCOWAPSA-M |
| XLogP | -5.44 |
| TPSA | 199.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.53 |
| LogP ≤ 5 | -5.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|