C19H24N5NaO5S2 — CID 88627232
sodium (2S,5R,6S)-6-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(1-methylcyclopentyl)oxyiminoacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 88627232) has the molecular formula C19H24N5NaO5S2 and a molecular weight of 489.56 g/mol. Its IUPAC name is sodium (2S,5R,6S)-6-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(1-methylcyclopentyl)oxyiminoacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | sodium (2S,5R,6S)-6-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(1-methylcyclopentyl)oxyiminoacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 88627232 |
| Molecular Formula | C19H24N5NaO5S2 |
| Molecular Weight | 489.56 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | sodium (2S,5R,6S)-6-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(1-methylcyclopentyl)oxyiminoacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC1(O/N=C(\C(=O)N[C@H]2C(=O)N3[C@@H]2SC(C)(C)[C@@H]3C(=O)[O-])c2csc(N)n2)CCCC1.[Na+] |
| InChI | InChI=1S/C19H25N5O5S2.Na/c1-18(2)12(16(27)28)24-14(26)11(15(24)31-18)22-13(25)10(9-8-30-17(20)21-9)23-29-19(3)6-4-5-7-19;/h8,11-12,15H,4-7H2,1-3H3,(H2,20,21)(H,22,25)(H,27,28);/q;+1/p-1/b23-10-;/t11-,12-,15+;/m0./s1 |
| InChIKey | ZWHASNFPPQUGDM-YGDJPMQRSA-M |
| XLogP | -2.92 |
| TPSA | 150.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.56 |
| LogP ≤ 5 | -2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|