C16H17Cl2N5O5S2 — CID 88627640
(2S,5R,6S)-6-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(3,3-dichloroprop-2-enoxyimino)acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 88627640) has the molecular formula C16H17Cl2N5O5S2 and a molecular weight of 494.38 g/mol. Its IUPAC name is (2S,5R,6S)-6-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(3,3-dichloroprop-2-enoxyimino)acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,5R,6S)-6-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(3,3-dichloroprop-2-enoxyimino)acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 88627640 |
| Molecular Formula | C16H17Cl2N5O5S2 |
| Molecular Weight | 494.38 g/mol |
| Exact Mass | 493.00 |
| IUPAC Name | (2S,5R,6S)-6-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(3,3-dichloroprop-2-enoxyimino)acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CC1(C)S[C@@H]2[C@@H](NC(=O)/C(=N\OCC=C(Cl)Cl)c3csc(N)n3)C(=O)N2[C@H]1C(=O)O |
| InChI | InChI=1S/C16H17Cl2N5O5S2/c1-16(2)10(14(26)27)23-12(25)9(13(23)30-16)21-11(24)8(6-5-29-15(19)20-6)22-28-4-3-7(17)18/h3,5,9-10,13H,4H2,1-2H3,(H2,19,20)(H,21,24)(H,26,27)/b22-8-/t9-,10-,13+/m0/s1 |
| InChIKey | DRDZPXIISXLHRE-PGZBIWBCSA-N |
| XLogP | 1.40 |
| TPSA | 147.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.38 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|