C17H21N5O7S3 — CID 88627060
(2S,5R,6S)-6-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(1,1-dioxothiolan-3-yl)oxyiminoacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 88627060) has the molecular formula C17H21N5O7S3 and a molecular weight of 503.58 g/mol. Its IUPAC name is (2S,5R,6S)-6-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(1,1-dioxothiolan-3-yl)oxyiminoacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,5R,6S)-6-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(1,1-dioxothiolan-3-yl)oxyiminoacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 88627060 |
| Molecular Formula | C17H21N5O7S3 |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.06 |
| IUPAC Name | (2S,5R,6S)-6-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(1,1-dioxothiolan-3-yl)oxyiminoacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CC1(C)S[C@@H]2[C@@H](NC(=O)/C(=N\OC3CCS(=O)(=O)C3)c3csc(N)n3)C(=O)N2[C@H]1C(=O)O |
| InChI | InChI=1S/C17H21N5O7S3/c1-17(2)11(15(25)26)22-13(24)10(14(22)31-17)20-12(23)9(8-5-30-16(18)19-8)21-29-7-3-4-32(27,28)6-7/h5,7,10-11,14H,3-4,6H2,1-2H3,(H2,18,19)(H,20,23)(H,25,26)/b21-9-/t7?,10-,11-,14+/m0/s1 |
| InChIKey | MMPANCSZTOQNIV-QZRUNIJDSA-N |
| XLogP | -0.74 |
| TPSA | 181.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|