C13H15N5O6S2 — CID 172943888
(6R,7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-hydroxy-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylic acid (PubChem CID 172943888) has the molecular formula C13H15N5O6S2 and a molecular weight of 401.43 g/mol. Its IUPAC name is (6R,7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-hydroxy-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylic acid.
| Compound Name | (6R,7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-hydroxy-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylic acid |
|---|---|
| PubChem CID | 172943888 |
| Molecular Formula | C13H15N5O6S2 |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | (6R,7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-hydroxy-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylic acid |
| SMILES | CO/N=C(\C(=O)N[C@@H]1C(=O)N2C(C(=O)O)C(O)CS[C@H]12)c1csc(N)n1 |
| InChI | InChI=1S/C13H15N5O6S2/c1-24-17-6(4-2-26-13(14)15-4)9(20)16-7-10(21)18-8(12(22)23)5(19)3-25-11(7)18/h2,5,7-8,11,19H,3H2,1H3,(H2,14,15)(H,16,20)(H,22,23)/b17-6-/t5?,7-,8?,11-/m1/s1 |
| InChIKey | QQHNSNYGVQXXKF-XXZCHOILSA-N |
| XLogP | -1.71 |
| TPSA | 167.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|