C15H17N5O6S3 — CID 90783868
(6R,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(methoxymethylsulfanyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 90783868) has the molecular formula C15H17N5O6S3 and a molecular weight of 459.53 g/mol. Its IUPAC name is (6R,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(methoxymethylsulfanyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(methoxymethylsulfanyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 90783868 |
| Molecular Formula | C15H17N5O6S3 |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.03 |
| IUPAC Name | (6R,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(methoxymethylsulfanyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | COCSC1=C(C(=O)O)N2C(=O)[C@@H](NC(=O)C(=NOC)c3csc(N)n3)[C@H]2SC1 |
| InChI | InChI=1S/C15H17N5O6S3/c1-25-5-29-7-4-27-13-9(12(22)20(13)10(7)14(23)24)18-11(21)8(19-26-2)6-3-28-15(16)17-6/h3,9,13H,4-5H2,1-2H3,(H2,16,17)(H,18,21)(H,23,24)/t9-,13-/m1/s1 |
| InChIKey | YOPGQIJFFQMKGU-NOZJJQNGSA-N |
| XLogP | 0.11 |
| TPSA | 156.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|