C15H15N5O7S2 — CID 15117598
(1R,4R,5R,8S)-4-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3,10-dioxo-11-oxa-6-thia-2-azatricyclo[6.3.0.02,5]undecane-1-carboxylic acid (PubChem CID 15117598) has the molecular formula C15H15N5O7S2 and a molecular weight of 441.45 g/mol. Its IUPAC name is (1R,4R,5R,8S)-4-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3,10-dioxo-11-oxa-6-thia-2-azatricyclo[6.3.0.02,5]undecane-1-carboxylic acid.
| Compound Name | (1R,4R,5R,8S)-4-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3,10-dioxo-11-oxa-6-thia-2-azatricyclo[6.3.0.02,5]undecane-1-carboxylic acid |
|---|---|
| PubChem CID | 15117598 |
| Molecular Formula | C15H15N5O7S2 |
| Molecular Weight | 441.45 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | (1R,4R,5R,8S)-4-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3,10-dioxo-11-oxa-6-thia-2-azatricyclo[6.3.0.02,5]undecane-1-carboxylic acid |
| SMILES | CO/N=C(\C(=O)N[C@@H]1C(=O)N2[C@@H]1SC[C@H]1CC(=O)O[C@@]12C(=O)O)c1csc(N)n1 |
| InChI | InChI=1S/C15H15N5O7S2/c1-26-19-8(6-4-29-14(16)17-6)10(22)18-9-11(23)20-12(9)28-3-5-2-7(21)27-15(5,20)13(24)25/h4-5,9,12H,2-3H2,1H3,(H2,16,17)(H,18,22)(H,24,25)/b19-8-/t5-,9-,12-,15-/m1/s1 |
| InChIKey | WCUAPZALSFCGSY-XESSWBAQSA-N |
| XLogP | -1.18 |
| TPSA | 173.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.45 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|