C15H14N5O9S2- — CID 140883357
(1R,4R,5R,8R)-4-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3,6,6,10-tetraoxo-11-oxa-6λ6-thia-2-azatricyclo[6.3.0.02,5]undecane-1-carboxylate (PubChem CID 140883357) has the molecular formula C15H14N5O9S2- and a molecular weight of 472.44 g/mol. Its IUPAC name is (1R,4R,5R,8R)-4-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3,6,6,10-tetraoxo-11-oxa-6λ6-thia-2-azatricyclo[6.3.0.02,5]undecane-1-carboxylate.
| Compound Name | (1R,4R,5R,8R)-4-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3,6,6,10-tetraoxo-11-oxa-6λ6-thia-2-azatricyclo[6.3.0.02,5]undecane-1-carboxylate |
|---|---|
| PubChem CID | 140883357 |
| Molecular Formula | C15H14N5O9S2- |
| Molecular Weight | 472.44 g/mol |
| Exact Mass | 472.02 |
| IUPAC Name | (1R,4R,5R,8R)-4-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3,6,6,10-tetraoxo-11-oxa-6λ6-thia-2-azatricyclo[6.3.0.02,5]undecane-1-carboxylate |
| SMILES | CO/N=C(\C(=O)N[C@@H]1C(=O)N2[C@@H]1S(=O)(=O)C[C@@H]1CC(=O)O[C@@]12C(=O)[O-])c1csc(N)n1 |
| InChI | InChI=1S/C15H15N5O9S2/c1-28-19-8(6-3-30-14(16)17-6)10(22)18-9-11(23)20-12(9)31(26,27)4-5-2-7(21)29-15(5,20)13(24)25/h3,5,9,12H,2,4H2,1H3,(H2,16,17)(H,18,22)(H,24,25)/p-1/b19-8-/t5-,9+,12+,15+/m0/s1 |
| InChIKey | ZBIQNDBNDVLLMI-SBKXWKGQSA-M |
| XLogP | -3.83 |
| TPSA | 210.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.44 |
| LogP ≤ 5 | -3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|