C16H16N5O9S2- — CID 140883364
(1R,4R,5R,8R)-4-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-ethoxyiminoacetyl]amino]-3,6,6,10-tetraoxo-11-oxa-6λ6-thia-2-azatricyclo[6.3.0.02,5]undecane-1-carboxylate (PubChem CID 140883364) has the molecular formula C16H16N5O9S2- and a molecular weight of 486.46 g/mol. Its IUPAC name is (1R,4R,5R,8R)-4-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-ethoxyiminoacetyl]amino]-3,6,6,10-tetraoxo-11-oxa-6λ6-thia-2-azatricyclo[6.3.0.02,5]undecane-1-carboxylate.
| Compound Name | (1R,4R,5R,8R)-4-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-ethoxyiminoacetyl]amino]-3,6,6,10-tetraoxo-11-oxa-6λ6-thia-2-azatricyclo[6.3.0.02,5]undecane-1-carboxylate |
|---|---|
| PubChem CID | 140883364 |
| Molecular Formula | C16H16N5O9S2- |
| Molecular Weight | 486.46 g/mol |
| Exact Mass | 486.04 |
| IUPAC Name | (1R,4R,5R,8R)-4-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-ethoxyiminoacetyl]amino]-3,6,6,10-tetraoxo-11-oxa-6λ6-thia-2-azatricyclo[6.3.0.02,5]undecane-1-carboxylate |
| SMILES | CCO/N=C(\C(=O)N[C@@H]1C(=O)N2[C@@H]1S(=O)(=O)C[C@@H]1CC(=O)O[C@@]12C(=O)[O-])c1csc(N)n1 |
| InChI | InChI=1S/C16H17N5O9S2/c1-2-29-20-9(7-4-31-15(17)18-7)11(23)19-10-12(24)21-13(10)32(27,28)5-6-3-8(22)30-16(6,21)14(25)26/h4,6,10,13H,2-3,5H2,1H3,(H2,17,18)(H,19,23)(H,25,26)/p-1/b20-9-/t6-,10+,13+,16+/m0/s1 |
| InChIKey | KIGRYZQAFXNINV-RRNSYEGLSA-M |
| XLogP | -3.44 |
| TPSA | 210.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.46 |
| LogP ≤ 5 | -3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|