C11H15N5O3S2 — CID 143301449
(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-ethoxyimino-N-(1-methyl-2-oxo-4-sulfanylazetidin-3-yl)acetamide (PubChem CID 143301449) has the molecular formula C11H15N5O3S2 and a molecular weight of 329.41 g/mol. Its IUPAC name is (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-ethoxyimino-N-(1-methyl-2-oxo-4-sulfanylazetidin-3-yl)acetamide.
| Compound Name | (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-ethoxyimino-N-(1-methyl-2-oxo-4-sulfanylazetidin-3-yl)acetamide |
|---|---|
| PubChem CID | 143301449 |
| Molecular Formula | C11H15N5O3S2 |
| Molecular Weight | 329.41 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-ethoxyimino-N-(1-methyl-2-oxo-4-sulfanylazetidin-3-yl)acetamide |
| SMILES | CCO/N=C(\C(=O)NC1C(=O)N(C)C1S)c1csc(N)n1 |
| InChI | InChI=1S/C11H15N5O3S2/c1-3-19-15-6(5-4-21-11(12)13-5)8(17)14-7-9(18)16(2)10(7)20/h4,7,10,20H,3H2,1-2H3,(H2,12,13)(H,14,17)/b15-6- |
| InChIKey | CGMRKUQXSQPATL-UUASQNMZSA-N |
| XLogP | -0.32 |
| TPSA | 109.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.41 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|