C13H13N5Na2O8S — CID 88649775
disodium;2-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-[[(2S,3S)-1-(carboxylatomethoxy)-2-methyl-4-oxoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxyacetate (PubChem CID 88649775) has the molecular formula C13H13N5Na2O8S and a molecular weight of 445.32 g/mol. Its IUPAC name is disodium;2-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-[[(2S,3S)-1-(carboxylatomethoxy)-2-methyl-4-oxoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxyacetate.
| Compound Name | disodium;2-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-[[(2S,3S)-1-(carboxylatomethoxy)-2-methyl-4-oxoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxyacetate |
|---|---|
| PubChem CID | 88649775 |
| Molecular Formula | C13H13N5Na2O8S |
| Molecular Weight | 445.32 g/mol |
| Exact Mass | 445.03 |
| IUPAC Name | disodium;2-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-[[(2S,3S)-1-(carboxylatomethoxy)-2-methyl-4-oxoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxyacetate |
| SMILES | C[C@H]1[C@H](NC(=O)/C(=N\OCC(=O)[O-])c2csc(N)n2)C(=O)N1OCC(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C13H15N5O8S.2Na/c1-5-9(12(24)18(5)26-3-8(21)22)16-11(23)10(17-25-2-7(19)20)6-4-27-13(14)15-6;;/h4-5,9H,2-3H2,1H3,(H2,14,15)(H,16,23)(H,19,20)(H,21,22);;/q;2*+1/p-2/b17-10-;;/t5-,9-;;/m0../s1 |
| InChIKey | MGHUNOZEPCIYPE-BXIZSAIJSA-L |
| XLogP | -10.40 |
| TPSA | 199.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.32 |
| LogP ≤ 5 | -10.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|