C15H17N5O7S — CID 56993386
prop-2-ynyl 2-[(2S,3S)-3-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-methyl-4-oxoazetidin-1-yl]peroxyacetate (PubChem CID 56993386) has the molecular formula C15H17N5O7S and a molecular weight of 411.40 g/mol. Its IUPAC name is prop-2-ynyl 2-[(2S,3S)-3-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-methyl-4-oxoazetidin-1-yl]peroxyacetate.
| Compound Name | prop-2-ynyl 2-[(2S,3S)-3-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-methyl-4-oxoazetidin-1-yl]peroxyacetate |
|---|---|
| PubChem CID | 56993386 |
| Molecular Formula | C15H17N5O7S |
| Molecular Weight | 411.40 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | prop-2-ynyl 2-[(2S,3S)-3-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-methyl-4-oxoazetidin-1-yl]peroxyacetate |
| SMILES | C#CCOC(=O)COON1C(=O)[C@@H](NC(=O)C(=NOC)c2csc(N)n2)[C@@H]1C |
| InChI | InChI=1S/C15H17N5O7S/c1-4-5-25-10(21)6-26-27-20-8(2)11(14(20)23)18-13(22)12(19-24-3)9-7-28-15(16)17-9/h1,7-8,11H,5-6H2,2-3H3,(H2,16,17)(H,18,22)/t8-,11-/m0/s1 |
| InChIKey | DHUIIGMRRPILBJ-KWQFWETISA-N |
| XLogP | -1.17 |
| TPSA | 154.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.40 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|