C14H20N5O8PS — CID 57051383
2-[3-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-methyl-4-oxoazetidin-1-yl]-2-dimethoxyphosphorylacetic acid (PubChem CID 57051383) has the molecular formula C14H20N5O8PS and a molecular weight of 449.38 g/mol. Its IUPAC name is 2-[3-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-methyl-4-oxoazetidin-1-yl]-2-dimethoxyphosphorylacetic acid.
| Compound Name | 2-[3-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-methyl-4-oxoazetidin-1-yl]-2-dimethoxyphosphorylacetic acid |
|---|---|
| PubChem CID | 57051383 |
| Molecular Formula | C14H20N5O8PS |
| Molecular Weight | 449.38 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | 2-[3-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-methyl-4-oxoazetidin-1-yl]-2-dimethoxyphosphorylacetic acid |
| SMILES | CON=C(C(=O)NC1C(=O)N(C(C(=O)O)P(=O)(OC)OC)C1C)c1csc(N)n1 |
| InChI | InChI=1S/C14H20N5O8PS/c1-6-8(11(21)19(6)12(13(22)23)28(24,26-3)27-4)17-10(20)9(18-25-2)7-5-29-14(15)16-7/h5-6,8,12H,1-4H3,(H2,15,16)(H,17,20)(H,22,23) |
| InChIKey | RRTSWIKBELTLMU-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 182.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.38 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|