C11H16N5O7PS — CID 57237713
[(2S,3S)-3-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-methyl-4-oxoazetidin-1-yl]oxymethylphosphonic acid (PubChem CID 57237713) has the molecular formula C11H16N5O7PS and a molecular weight of 393.32 g/mol. Its IUPAC name is [(2S,3S)-3-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-methyl-4-oxoazetidin-1-yl]oxymethylphosphonic acid.
| Compound Name | [(2S,3S)-3-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-methyl-4-oxoazetidin-1-yl]oxymethylphosphonic acid |
|---|---|
| PubChem CID | 57237713 |
| Molecular Formula | C11H16N5O7PS |
| Molecular Weight | 393.32 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | [(2S,3S)-3-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-methyl-4-oxoazetidin-1-yl]oxymethylphosphonic acid |
| SMILES | CON=C(C(=O)N[C@@H]1C(=O)N(OCP(=O)(O)O)[C@H]1C)c1csc(N)n1 |
| InChI | InChI=1S/C11H16N5O7PS/c1-5-7(10(18)16(5)23-4-24(19,20)21)14-9(17)8(15-22-2)6-3-25-11(12)13-6/h3,5,7H,4H2,1-2H3,(H2,12,13)(H,14,17)(H2,19,20,21)/t5-,7-/m0/s1 |
| InChIKey | QBVGKLLPMKIRMC-FSPLSTOPSA-N |
| XLogP | -1.14 |
| TPSA | 176.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.32 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|