C12H15N5O6S — CID 3047808
2-[3-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-methyl-4-oxoazetidin-1-yl]oxyacetic acid (PubChem CID 3047808) has the molecular formula C12H15N5O6S and a molecular weight of 357.35 g/mol. Its IUPAC name is 2-[3-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-methyl-4-oxoazetidin-1-yl]oxyacetic acid.
| Compound Name | 2-[3-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-methyl-4-oxoazetidin-1-yl]oxyacetic acid |
|---|---|
| PubChem CID | 3047808 |
| Molecular Formula | C12H15N5O6S |
| Molecular Weight | 357.35 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 2-[3-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-methyl-4-oxoazetidin-1-yl]oxyacetic acid |
| SMILES | CON=C(C(=O)NC1C(=O)N(OCC(=O)O)C1C)c1csc(N)n1 |
| InChI | InChI=1S/C12H15N5O6S/c1-5-8(11(21)17(5)23-3-7(18)19)15-10(20)9(16-22-2)6-4-24-12(13)14-6/h4-5,8H,3H2,1-2H3,(H2,13,14)(H,15,20)(H,18,19) |
| InChIKey | FJKOYBHMMTVFHK-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 156.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.35 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|