C10H13N5O7S2 — CID 88628878
(2R,3R)-3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-(hydroxymethyl)-4-oxoazetidine-1-sulfonic acid (PubChem CID 88628878) has the molecular formula C10H13N5O7S2 and a molecular weight of 379.38 g/mol. Its IUPAC name is (2R,3R)-3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-(hydroxymethyl)-4-oxoazetidine-1-sulfonic acid.
| Compound Name | (2R,3R)-3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-(hydroxymethyl)-4-oxoazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 88628878 |
| Molecular Formula | C10H13N5O7S2 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.03 |
| IUPAC Name | (2R,3R)-3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-(hydroxymethyl)-4-oxoazetidine-1-sulfonic acid |
| SMILES | CO/N=C(\C(=O)N[C@H]1C(=O)N(S(=O)(=O)O)[C@H]1CO)c1csc(N)n1 |
| InChI | InChI=1S/C10H13N5O7S2/c1-22-14-6(4-3-23-10(11)12-4)8(17)13-7-5(2-16)15(9(7)18)24(19,20)21/h3,5,7,16H,2H2,1H3,(H2,11,12)(H,13,17)(H,19,20,21)/b14-6-/t5-,7+/m0/s1 |
| InChIKey | HVZIGLPZAJUSPZ-XKHJTPRQSA-N |
| XLogP | -2.43 |
| TPSA | 184.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|