C11H11N5O6S2 — CID 88615525
(2R,3S)-3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-ethynyl-4-oxoazetidine-1-sulfonic acid (PubChem CID 88615525) has the molecular formula C11H11N5O6S2 and a molecular weight of 373.37 g/mol. Its IUPAC name is (2R,3S)-3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-ethynyl-4-oxoazetidine-1-sulfonic acid.
| Compound Name | (2R,3S)-3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-ethynyl-4-oxoazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 88615525 |
| Molecular Formula | C11H11N5O6S2 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.02 |
| IUPAC Name | (2R,3S)-3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-ethynyl-4-oxoazetidine-1-sulfonic acid |
| SMILES | C#C[C@@H]1[C@H](NC(=O)/C(=N\OC)c2csc(N)n2)C(=O)N1S(=O)(=O)O |
| InChI | InChI=1S/C11H11N5O6S2/c1-3-6-8(10(18)16(6)24(19,20)21)14-9(17)7(15-22-2)5-4-23-11(12)13-5/h1,4,6,8H,2H3,(H2,12,13)(H,14,17)(H,19,20,21)/b15-7-/t6-,8+/m1/s1 |
| InChIKey | GFQRAYFTDGUNFQ-WIDWHOJOSA-N |
| XLogP | -1.79 |
| TPSA | 164.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|