C18H32N6O6S2 — CID 88615593
(3S,4S)-3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-oxo-4-propylazetidine-1-sulfonic acid;N,N-diethylethanamine (PubChem CID 88615593) has the molecular formula C18H32N6O6S2 and a molecular weight of 492.62 g/mol. Its IUPAC name is (3S,4S)-3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-oxo-4-propylazetidine-1-sulfonic acid;N,N-diethylethanamine.
| Compound Name | (3S,4S)-3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-oxo-4-propylazetidine-1-sulfonic acid;N,N-diethylethanamine |
|---|---|
| PubChem CID | 88615593 |
| Molecular Formula | C18H32N6O6S2 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | (3S,4S)-3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-oxo-4-propylazetidine-1-sulfonic acid;N,N-diethylethanamine |
| SMILES | CCC[C@H]1[C@H](NC(=O)/C(=N\OC)c2csc(N)n2)C(=O)N1S(=O)(=O)O.CCN(CC)CC |
| InChI | InChI=1S/C12H17N5O6S2.C6H15N/c1-3-4-7-9(11(19)17(7)25(20,21)22)15-10(18)8(16-23-2)6-5-24-12(13)14-6;1-4-7(5-2)6-3/h5,7,9H,3-4H2,1-2H3,(H2,13,14)(H,15,18)(H,20,21,22);4-6H2,1-3H3/b16-8-;/t7-,9-;/m0./s1 |
| InChIKey | NICFLBOVRSRGGA-CNICYKJPSA-N |
| XLogP | 0.72 |
| TPSA | 167.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|