C12H14N6O9S2 — CID 54347523
2-[[3-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-4-oxo-1-sulfoazetidin-2-yl]methoxyimino]acetic acid (PubChem CID 54347523) has the molecular formula C12H14N6O9S2 and a molecular weight of 450.41 g/mol. Its IUPAC name is 2-[[3-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-4-oxo-1-sulfoazetidin-2-yl]methoxyimino]acetic acid.
| Compound Name | 2-[[3-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-4-oxo-1-sulfoazetidin-2-yl]methoxyimino]acetic acid |
|---|---|
| PubChem CID | 54347523 |
| Molecular Formula | C12H14N6O9S2 |
| Molecular Weight | 450.41 g/mol |
| Exact Mass | 450.03 |
| IUPAC Name | 2-[[3-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-4-oxo-1-sulfoazetidin-2-yl]methoxyimino]acetic acid |
| SMILES | CON=C(C(=O)NC1C(=O)N(S(=O)(=O)O)C1CON=CC(=O)O)c1csc(N)n1 |
| InChI | InChI=1S/C12H14N6O9S2/c1-26-17-8(5-4-28-12(13)15-5)10(21)16-9-6(3-27-14-2-7(19)20)18(11(9)22)29(23,24)25/h2,4,6,9H,3H2,1H3,(H2,13,15)(H,16,21)(H,19,20)(H,23,24,25) |
| InChIKey | UDIILLLKUIXLJO-UHFFFAOYSA-N |
| XLogP | -2.34 |
| TPSA | 223.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.41 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|