C16H17N5O8S3 — CID 88649626
(3R,4R)-3-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-oxo-4-[(2-thiophen-2-ylacetyl)oxymethyl]azetidine-1-sulfonic acid (PubChem CID 88649626) has the molecular formula C16H17N5O8S3 and a molecular weight of 503.54 g/mol. Its IUPAC name is (3R,4R)-3-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-oxo-4-[(2-thiophen-2-ylacetyl)oxymethyl]azetidine-1-sulfonic acid.
| Compound Name | (3R,4R)-3-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-oxo-4-[(2-thiophen-2-ylacetyl)oxymethyl]azetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 88649626 |
| Molecular Formula | C16H17N5O8S3 |
| Molecular Weight | 503.54 g/mol |
| Exact Mass | 503.02 |
| IUPAC Name | (3R,4R)-3-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-oxo-4-[(2-thiophen-2-ylacetyl)oxymethyl]azetidine-1-sulfonic acid |
| SMILES | CON=C(C(=O)N[C@H]1C(=O)N(S(=O)(=O)O)[C@H]1COC(=O)Cc1cccs1)c1csc(N)n1 |
| InChI | InChI=1S/C16H17N5O8S3/c1-28-20-12(9-7-31-16(17)18-9)14(23)19-13-10(21(15(13)24)32(25,26)27)6-29-11(22)5-8-3-2-4-30-8/h2-4,7,10,13H,5-6H2,1H3,(H2,17,18)(H,19,23)(H,25,26,27)/t10-,13+/m0/s1 |
| InChIKey | CYUFUDUKAOTNBZ-GXFFZTMASA-N |
| XLogP | -0.58 |
| TPSA | 190.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.54 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|