C17H18N6O7S2 — CID 57266958
(2S,3R)-3-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-(benzamidomethyl)-4-oxoazetidine-1-sulfonic acid (PubChem CID 57266958) has the molecular formula C17H18N6O7S2 and a molecular weight of 482.50 g/mol. Its IUPAC name is (2S,3R)-3-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-(benzamidomethyl)-4-oxoazetidine-1-sulfonic acid.
| Compound Name | (2S,3R)-3-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-(benzamidomethyl)-4-oxoazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 57266958 |
| Molecular Formula | C17H18N6O7S2 |
| Molecular Weight | 482.50 g/mol |
| Exact Mass | 482.07 |
| IUPAC Name | (2S,3R)-3-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-(benzamidomethyl)-4-oxoazetidine-1-sulfonic acid |
| SMILES | CON=C(C(=O)N[C@H]1C(=O)N(S(=O)(=O)O)[C@H]1CNC(=O)c1ccccc1)c1csc(N)n1 |
| InChI | InChI=1S/C17H18N6O7S2/c1-30-22-12(10-8-31-17(18)20-10)15(25)21-13-11(23(16(13)26)32(27,28)29)7-19-14(24)9-5-3-2-4-6-9/h2-6,8,11,13H,7H2,1H3,(H2,18,20)(H,19,24)(H,21,25)(H,27,28,29)/t11-,13+/m0/s1 |
| InChIKey | MTWXTITXFQTKSK-WCQYABFASA-N |
| XLogP | -1.00 |
| TPSA | 193.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.50 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|