C13H16N6O9S2 — CID 57195567
2-[[2-[[2-(acetamidomethyl)-4-oxo-1-sulfoazetidin-3-yl]amino]-1-(2-amino-1,3-thiazol-4-yl)-2-oxoethylidene]amino]oxyacetic acid (PubChem CID 57195567) has the molecular formula C13H16N6O9S2 and a molecular weight of 464.44 g/mol. Its IUPAC name is 2-[[2-[[2-(acetamidomethyl)-4-oxo-1-sulfoazetidin-3-yl]amino]-1-(2-amino-1,3-thiazol-4-yl)-2-oxoethylidene]amino]oxyacetic acid.
| Compound Name | 2-[[2-[[2-(acetamidomethyl)-4-oxo-1-sulfoazetidin-3-yl]amino]-1-(2-amino-1,3-thiazol-4-yl)-2-oxoethylidene]amino]oxyacetic acid |
|---|---|
| PubChem CID | 57195567 |
| Molecular Formula | C13H16N6O9S2 |
| Molecular Weight | 464.44 g/mol |
| Exact Mass | 464.04 |
| IUPAC Name | 2-[[2-[[2-(acetamidomethyl)-4-oxo-1-sulfoazetidin-3-yl]amino]-1-(2-amino-1,3-thiazol-4-yl)-2-oxoethylidene]amino]oxyacetic acid |
| SMILES | CC(=O)NCC1C(NC(=O)C(=NOCC(=O)O)c2csc(N)n2)C(=O)N1S(=O)(=O)O |
| InChI | InChI=1S/C13H16N6O9S2/c1-5(20)15-2-7-10(12(24)19(7)30(25,26)27)17-11(23)9(18-28-3-8(21)22)6-4-29-13(14)16-6/h4,7,10H,2-3H2,1H3,(H2,14,16)(H,15,20)(H,17,23)(H,21,22)(H,25,26,27) |
| InChIKey | PRHRRDOGUPQKER-UHFFFAOYSA-N |
| XLogP | -2.83 |
| TPSA | 230.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.44 |
| LogP ≤ 5 | -2.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|