C13H13N5O11S2 — CID 54430052
2-[[1-(2-amino-1,3-thiazol-4-yl)-2-[[2-(2-methoxy-2-oxoacetyl)-4-oxo-1-sulfoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxyacetic acid (PubChem CID 54430052) has the molecular formula C13H13N5O11S2 and a molecular weight of 479.41 g/mol. Its IUPAC name is 2-[[1-(2-amino-1,3-thiazol-4-yl)-2-[[2-(2-methoxy-2-oxoacetyl)-4-oxo-1-sulfoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxyacetic acid.
| Compound Name | 2-[[1-(2-amino-1,3-thiazol-4-yl)-2-[[2-(2-methoxy-2-oxoacetyl)-4-oxo-1-sulfoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxyacetic acid |
|---|---|
| PubChem CID | 54430052 |
| Molecular Formula | C13H13N5O11S2 |
| Molecular Weight | 479.41 g/mol |
| Exact Mass | 479.01 |
| IUPAC Name | 2-[[1-(2-amino-1,3-thiazol-4-yl)-2-[[2-(2-methoxy-2-oxoacetyl)-4-oxo-1-sulfoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxyacetic acid |
| SMILES | COC(=O)C(=O)C1C(NC(=O)C(=NOCC(=O)O)c2csc(N)n2)C(=O)N1S(=O)(=O)O |
| InChI | InChI=1S/C13H13N5O11S2/c1-28-12(24)9(21)8-7(11(23)18(8)31(25,26)27)16-10(22)6(17-29-2-5(19)20)4-3-30-13(14)15-4/h3,7-8H,2H2,1H3,(H2,14,15)(H,16,22)(H,19,20)(H,25,26,27) |
| InChIKey | WGVQNBBARBZUFO-UHFFFAOYSA-N |
| XLogP | -3.23 |
| TPSA | 244.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.41 |
| LogP ≤ 5 | -3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|