C11H14N6O7S2 — CID 88627832
(2R,3R)-3-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-(methylcarbamoyl)-4-oxoazetidine-1-sulfonic acid (PubChem CID 88627832) has the molecular formula C11H14N6O7S2 and a molecular weight of 406.40 g/mol. Its IUPAC name is (2R,3R)-3-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-(methylcarbamoyl)-4-oxoazetidine-1-sulfonic acid.
| Compound Name | (2R,3R)-3-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-(methylcarbamoyl)-4-oxoazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 88627832 |
| Molecular Formula | C11H14N6O7S2 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | (2R,3R)-3-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-(methylcarbamoyl)-4-oxoazetidine-1-sulfonic acid |
| SMILES | CNC(=O)[C@H]1[C@@H](NC(=O)C(=NOC)c2csc(N)n2)C(=O)N1S(=O)(=O)O |
| InChI | InChI=1S/C11H14N6O7S2/c1-13-9(19)7-6(10(20)17(7)26(21,22)23)15-8(18)5(16-24-2)4-3-25-11(12)14-4/h3,6-7H,1-2H3,(H2,12,14)(H,13,19)(H,15,18)(H,21,22,23)/t6-,7-/m1/s1 |
| InChIKey | GZTOLNSFEFJWTL-RNFRBKRXSA-N |
| XLogP | -2.68 |
| TPSA | 193.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | -2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|