C11H15N5O6S3 — CID 21244945
3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-(methylsulfanylmethyl)-4-oxoazetidine-1-sulfonic acid (PubChem CID 21244945) has the molecular formula C11H15N5O6S3 and a molecular weight of 409.47 g/mol. Its IUPAC name is 3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-(methylsulfanylmethyl)-4-oxoazetidine-1-sulfonic acid.
| Compound Name | 3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-(methylsulfanylmethyl)-4-oxoazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 21244945 |
| Molecular Formula | C11H15N5O6S3 |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.02 |
| IUPAC Name | 3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-(methylsulfanylmethyl)-4-oxoazetidine-1-sulfonic acid |
| SMILES | CO/N=C(\C(=O)NC1C(=O)N(S(=O)(=O)O)C1CSC)c1csc(N)n1 |
| InChI | InChI=1S/C11H15N5O6S3/c1-22-15-7(5-3-24-11(12)13-5)9(17)14-8-6(4-23-2)16(10(8)18)25(19,20)21/h3,6,8H,4H2,1-2H3,(H2,12,13)(H,14,17)(H,19,20,21)/b15-7- |
| InChIKey | JHODGDMVEVGHCZ-CHHVJCJISA-N |
| XLogP | -1.06 |
| TPSA | 164.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|