C10H12N6O7S2 — CID 57194232
(2R,3S)-3-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-(nitrosomethyl)-4-oxoazetidine-1-sulfonic acid (PubChem CID 57194232) has the molecular formula C10H12N6O7S2 and a molecular weight of 392.38 g/mol. Its IUPAC name is (2R,3S)-3-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-(nitrosomethyl)-4-oxoazetidine-1-sulfonic acid.
| Compound Name | (2R,3S)-3-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-(nitrosomethyl)-4-oxoazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 57194232 |
| Molecular Formula | C10H12N6O7S2 |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.02 |
| IUPAC Name | (2R,3S)-3-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-(nitrosomethyl)-4-oxoazetidine-1-sulfonic acid |
| SMILES | CON=C(C(=O)N[C@@H]1C(=O)N(S(=O)(=O)O)[C@@H]1CN=O)c1csc(N)n1 |
| InChI | InChI=1S/C10H12N6O7S2/c1-23-15-6(4-3-24-10(11)13-4)8(17)14-7-5(2-12-19)16(9(7)18)25(20,21)22/h3,5,7H,2H2,1H3,(H2,11,13)(H,14,17)(H,20,21,22)/t5-,7+/m1/s1 |
| InChIKey | IEKDDAKPAZJYPR-VDTYLAMSSA-N |
| XLogP | -1.66 |
| TPSA | 193.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|