C19H19ClN6O8S2 — CID 88628249
(2S,3R)-2-(benzamidomethyl)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidine-1-sulfonic acid (PubChem CID 88628249) has the molecular formula C19H19ClN6O8S2 and a molecular weight of 558.98 g/mol. Its IUPAC name is (2S,3R)-2-(benzamidomethyl)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidine-1-sulfonic acid.
| Compound Name | (2S,3R)-2-(benzamidomethyl)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 88628249 |
| Molecular Formula | C19H19ClN6O8S2 |
| Molecular Weight | 558.98 g/mol |
| Exact Mass | 558.04 |
| IUPAC Name | (2S,3R)-2-(benzamidomethyl)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidine-1-sulfonic acid |
| SMILES | CON=C(C(=O)N[C@H]1C(=O)N(S(=O)(=O)O)[C@H]1CNC(=O)c1ccccc1)c1csc(NC(=O)CCl)n1 |
| InChI | InChI=1S/C19H19ClN6O8S2/c1-34-25-14(11-9-35-19(22-11)23-13(27)7-20)17(29)24-15-12(26(18(15)30)36(31,32)33)8-21-16(28)10-5-3-2-4-6-10/h2-6,9,12,15H,7-8H2,1H3,(H,21,28)(H,24,29)(H,22,23,27)(H,31,32,33)/t12-,15+/m0/s1 |
| InChIKey | VASDCLIOVJMDFB-SWLSCSKDSA-N |
| XLogP | -0.40 |
| TPSA | 196.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.98 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|