C11H11ClN8O7S2 — CID 57207217
(3S)-2-azido-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidine-1-sulfonic acid (PubChem CID 57207217) has the molecular formula C11H11ClN8O7S2 and a molecular weight of 466.85 g/mol. Its IUPAC name is (3S)-2-azido-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidine-1-sulfonic acid.
| Compound Name | (3S)-2-azido-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 57207217 |
| Molecular Formula | C11H11ClN8O7S2 |
| Molecular Weight | 466.85 g/mol |
| Exact Mass | 465.99 |
| IUPAC Name | (3S)-2-azido-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidine-1-sulfonic acid |
| SMILES | CON=C(C(=O)N[C@@H]1C(=O)N(S(=O)(=O)O)C1N=[N+]=[N-])c1csc(NC(=O)CCl)n1 |
| InChI | InChI=1S/C11H11ClN8O7S2/c1-27-18-6(4-3-28-11(14-4)15-5(21)2-12)9(22)16-7-8(17-19-13)20(10(7)23)29(24,25)26/h3,7-8H,2H2,1H3,(H,16,22)(H,14,15,21)(H,24,25,26)/t7-,8?/m0/s1 |
| InChIKey | LBSIDEQPWJQXLA-JAMMHHFISA-N |
| XLogP | -0.56 |
| TPSA | 216.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.85 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|