C13H15ClN6O9S2 — CID 21244766
2-(carbamoyloxymethyl)-3-[[(2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidine-1-sulfonic acid (PubChem CID 21244766) has the molecular formula C13H15ClN6O9S2 and a molecular weight of 498.88 g/mol. Its IUPAC name is 2-(carbamoyloxymethyl)-3-[[(2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidine-1-sulfonic acid.
| Compound Name | 2-(carbamoyloxymethyl)-3-[[(2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 21244766 |
| Molecular Formula | C13H15ClN6O9S2 |
| Molecular Weight | 498.88 g/mol |
| Exact Mass | 498.00 |
| IUPAC Name | 2-(carbamoyloxymethyl)-3-[[(2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidine-1-sulfonic acid |
| SMILES | CO/N=C(\C(=O)NC1C(=O)N(S(=O)(=O)O)C1COC(N)=O)c1csc(NC(=O)CCl)n1 |
| InChI | InChI=1S/C13H15ClN6O9S2/c1-28-19-8(5-4-30-13(16-5)17-7(21)2-14)10(22)18-9-6(3-29-12(15)24)20(11(9)23)31(25,26)27/h4,6,9H,2-3H2,1H3,(H2,15,24)(H,18,22)(H,16,17,21)(H,25,26,27)/b19-8- |
| InChIKey | LMDAZIHVLUQOKH-UWVJOHFNSA-N |
| XLogP | -1.74 |
| TPSA | 219.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.88 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|