C13H14ClN5O9S2 — CID 88629207
(2S,3S)-2-acetyloxy-3-[[(2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidine-1-sulfonic acid (PubChem CID 88629207) has the molecular formula C13H14ClN5O9S2 and a molecular weight of 483.87 g/mol. Its IUPAC name is (2S,3S)-2-acetyloxy-3-[[(2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidine-1-sulfonic acid.
| Compound Name | (2S,3S)-2-acetyloxy-3-[[(2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 88629207 |
| Molecular Formula | C13H14ClN5O9S2 |
| Molecular Weight | 483.87 g/mol |
| Exact Mass | 482.99 |
| IUPAC Name | (2S,3S)-2-acetyloxy-3-[[(2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidine-1-sulfonic acid |
| SMILES | CO/N=C(\C(=O)N[C@@H]1C(=O)N(S(=O)(=O)O)[C@H]1OC(C)=O)c1csc(NC(=O)CCl)n1 |
| InChI | InChI=1S/C13H14ClN5O9S2/c1-5(20)28-12-9(11(23)19(12)30(24,25)26)17-10(22)8(18-27-2)6-4-29-13(15-6)16-7(21)3-14/h4,9,12H,3H2,1-2H3,(H,17,22)(H,15,16,21)(H,24,25,26)/b18-8-/t9-,12+/m1/s1 |
| InChIKey | OAAJAFQDWSICIN-BHHKJQIPSA-N |
| XLogP | -1.31 |
| TPSA | 193.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.87 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|