C12H13ClN6O8S2 — CID 56991863
(2R,3R)-2-carbamoyl-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidine-1-sulfonic acid (PubChem CID 56991863) has the molecular formula C12H13ClN6O8S2 and a molecular weight of 468.86 g/mol. Its IUPAC name is (2R,3R)-2-carbamoyl-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidine-1-sulfonic acid.
| Compound Name | (2R,3R)-2-carbamoyl-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 56991863 |
| Molecular Formula | C12H13ClN6O8S2 |
| Molecular Weight | 468.86 g/mol |
| Exact Mass | 467.99 |
| IUPAC Name | (2R,3R)-2-carbamoyl-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidine-1-sulfonic acid |
| SMILES | CON=C(C(=O)N[C@H]1C(=O)N(S(=O)(=O)O)[C@H]1C(N)=O)c1csc(NC(=O)CCl)n1 |
| InChI | InChI=1S/C12H13ClN6O8S2/c1-27-18-6(4-3-28-12(15-4)16-5(20)2-13)10(22)17-7-8(9(14)21)19(11(7)23)29(24,25)26/h3,7-8H,2H2,1H3,(H2,14,21)(H,17,22)(H,15,16,20)(H,24,25,26)/t7-,8-/m1/s1 |
| InChIKey | WZVAKJIGQZLJES-HTQZYQBOSA-N |
| XLogP | -2.35 |
| TPSA | 210.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.86 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|