C12H14ClFN5NaO7S2 — CID 173430682
sodium;3-[[(2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-2-(fluoromethyl)-4-oxoazetidine-1-sulfonic acid;hydride (PubChem CID 173430682) has the molecular formula C12H14ClFN5NaO7S2 and a molecular weight of 481.85 g/mol. Its IUPAC name is sodium;3-[[(2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-2-(fluoromethyl)-4-oxoazetidine-1-sulfonic acid;hydride.
| Compound Name | sodium;3-[[(2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-2-(fluoromethyl)-4-oxoazetidine-1-sulfonic acid;hydride |
|---|---|
| PubChem CID | 173430682 |
| Molecular Formula | C12H14ClFN5NaO7S2 |
| Molecular Weight | 481.85 g/mol |
| Exact Mass | 480.99 |
| IUPAC Name | sodium;3-[[(2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-2-(fluoromethyl)-4-oxoazetidine-1-sulfonic acid;hydride |
| SMILES | CO/N=C(\C(=O)NC1C(=O)N(S(=O)(=O)O)C1CF)c1csc(NC(=O)CCl)n1.[H-].[Na+] |
| InChI | InChI=1S/C12H13ClFN5O7S2.Na.H/c1-26-18-8(5-4-27-12(15-5)16-7(20)2-13)10(21)17-9-6(3-14)19(11(9)22)28(23,24)25;;/h4,6,9H,2-3H2,1H3,(H,17,21)(H,15,16,20)(H,23,24,25);;/q;+1;-1/b18-8-;; |
| InChIKey | JOTDBPZRJFNNGX-OHUGTHHSSA-N |
| XLogP | -3.74 |
| TPSA | 167.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.85 |
| LogP ≤ 5 | -3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|