C14H18ClN5O7S3 — CID 88628345
(3R,4S)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-2-oxo-4-propan-2-ylsulfanylazetidine-1-sulfonic acid (PubChem CID 88628345) has the molecular formula C14H18ClN5O7S3 and a molecular weight of 499.98 g/mol. Its IUPAC name is (3R,4S)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-2-oxo-4-propan-2-ylsulfanylazetidine-1-sulfonic acid.
| Compound Name | (3R,4S)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-2-oxo-4-propan-2-ylsulfanylazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 88628345 |
| Molecular Formula | C14H18ClN5O7S3 |
| Molecular Weight | 499.98 g/mol |
| Exact Mass | 499.01 |
| IUPAC Name | (3R,4S)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-2-oxo-4-propan-2-ylsulfanylazetidine-1-sulfonic acid |
| SMILES | CON=C(C(=O)N[C@@H]1C(=O)N(S(=O)(=O)O)[C@H]1SC(C)C)c1csc(NC(=O)CCl)n1 |
| InChI | InChI=1S/C14H18ClN5O7S3/c1-6(2)29-13-10(12(23)20(13)30(24,25)26)18-11(22)9(19-27-3)7-5-28-14(16-7)17-8(21)4-15/h5-6,10,13H,4H2,1-3H3,(H,18,22)(H,16,17,21)(H,24,25,26)/t10-,13+/m1/s1 |
| InChIKey | PMDFGVACJXVNIZ-MFKMUULPSA-N |
| XLogP | 0.27 |
| TPSA | 167.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.98 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|