C13H17N5O7S4 — CID 88627762
(2S,3R)-3-[[(2Z)-2-methoxyimino-2-[2-[(2-methylsulfanylacetyl)amino]-1,3-thiazol-4-yl]acetyl]amino]-2-methylsulfanyl-4-oxoazetidine-1-sulfonic acid (PubChem CID 88627762) has the molecular formula C13H17N5O7S4 and a molecular weight of 483.58 g/mol. Its IUPAC name is (2S,3R)-3-[[(2Z)-2-methoxyimino-2-[2-[(2-methylsulfanylacetyl)amino]-1,3-thiazol-4-yl]acetyl]amino]-2-methylsulfanyl-4-oxoazetidine-1-sulfonic acid.
| Compound Name | (2S,3R)-3-[[(2Z)-2-methoxyimino-2-[2-[(2-methylsulfanylacetyl)amino]-1,3-thiazol-4-yl]acetyl]amino]-2-methylsulfanyl-4-oxoazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 88627762 |
| Molecular Formula | C13H17N5O7S4 |
| Molecular Weight | 483.58 g/mol |
| Exact Mass | 483.00 |
| IUPAC Name | (2S,3R)-3-[[(2Z)-2-methoxyimino-2-[2-[(2-methylsulfanylacetyl)amino]-1,3-thiazol-4-yl]acetyl]amino]-2-methylsulfanyl-4-oxoazetidine-1-sulfonic acid |
| SMILES | CO/N=C(\C(=O)N[C@@H]1C(=O)N(S(=O)(=O)O)[C@H]1SC)c1csc(NC(=O)CSC)n1 |
| InChI | InChI=1S/C13H17N5O7S4/c1-25-17-8(6-4-28-13(14-6)15-7(19)5-26-2)10(20)16-9-11(21)18(12(9)27-3)29(22,23)24/h4,9,12H,5H2,1-3H3,(H,16,20)(H,14,15,19)(H,22,23,24)/b17-8-/t9-,12+/m1/s1 |
| InChIKey | CAAQHRVGGLYMNB-ULQYEZCCSA-N |
| XLogP | -0.39 |
| TPSA | 167.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.58 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|