C13H13ClN5NaO8S3 — CID 86740405
sodium (2R,3R)-2-acetylsulfanyl-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidine-1-sulfonate (PubChem CID 86740405) has the molecular formula C13H13ClN5NaO8S3 and a molecular weight of 521.92 g/mol. Its IUPAC name is sodium (2R,3R)-2-acetylsulfanyl-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidine-1-sulfonate.
| Compound Name | sodium (2R,3R)-2-acetylsulfanyl-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidine-1-sulfonate |
|---|---|
| PubChem CID | 86740405 |
| Molecular Formula | C13H13ClN5NaO8S3 |
| Molecular Weight | 521.92 g/mol |
| Exact Mass | 520.95 |
| IUPAC Name | sodium (2R,3R)-2-acetylsulfanyl-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidine-1-sulfonate |
| SMILES | CON=C(C(=O)N[C@@H]1C(=O)N(S(=O)(=O)[O-])[C@@H]1SC(C)=O)c1csc(NC(=O)CCl)n1.[Na+] |
| InChI | InChI=1S/C13H14ClN5O8S3.Na/c1-5(20)29-12-9(11(23)19(12)30(24,25)26)17-10(22)8(18-27-2)6-4-28-13(15-6)16-7(21)3-14;/h4,9,12H,3H2,1-2H3,(H,17,22)(H,15,16,21)(H,24,25,26);/q;+1/p-1/t9-,12-;/m1./s1 |
| InChIKey | DZQJCDDDRLYOQT-WYUVZMMLSA-M |
| XLogP | -3.93 |
| TPSA | 187.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.92 |
| LogP ≤ 5 | -3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|