C14H15ClN5NaO9S2 — CID 173396529
sodium (2R,3R)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-ethoxyiminoacetyl]amino]-2-methoxycarbonyl-4-oxoazetidine-1-sulfonate (PubChem CID 173396529) has the molecular formula C14H15ClN5NaO9S2 and a molecular weight of 519.88 g/mol. Its IUPAC name is sodium (2R,3R)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-ethoxyiminoacetyl]amino]-2-methoxycarbonyl-4-oxoazetidine-1-sulfonate.
| Compound Name | sodium (2R,3R)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-ethoxyiminoacetyl]amino]-2-methoxycarbonyl-4-oxoazetidine-1-sulfonate |
|---|---|
| PubChem CID | 173396529 |
| Molecular Formula | C14H15ClN5NaO9S2 |
| Molecular Weight | 519.88 g/mol |
| Exact Mass | 518.99 |
| IUPAC Name | sodium (2R,3R)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-ethoxyiminoacetyl]amino]-2-methoxycarbonyl-4-oxoazetidine-1-sulfonate |
| SMILES | CCON=C(C(=O)N[C@H]1C(=O)N(S(=O)(=O)[O-])[C@H]1C(=O)OC)c1csc(NC(=O)CCl)n1.[Na+] |
| InChI | InChI=1S/C14H16ClN5O9S2.Na/c1-3-29-19-8(6-5-30-14(16-6)17-7(21)4-15)11(22)18-9-10(13(24)28-2)20(12(9)23)31(25,26)27;/h5,9-10H,3-4H2,1-2H3,(H,18,22)(H,16,17,21)(H,25,26,27);/q;+1/p-1/t9-,10-;/m1./s1 |
| InChIKey | JTYQIAXITIEPFJ-DHTOPLTISA-M |
| XLogP | -4.61 |
| TPSA | 196.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.88 |
| LogP ≤ 5 | -4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|