C16H21ClN4NaO11PS2 — CID 88628537
sodium (2R,3R)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-diethoxyphosphorylacetyl]amino]-2-methoxycarbonyl-4-oxoazetidine-1-sulfonate (PubChem CID 88628537) has the molecular formula C16H21ClN4NaO11PS2 and a molecular weight of 598.91 g/mol. Its IUPAC name is sodium (2R,3R)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-diethoxyphosphorylacetyl]amino]-2-methoxycarbonyl-4-oxoazetidine-1-sulfonate.
| Compound Name | sodium (2R,3R)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-diethoxyphosphorylacetyl]amino]-2-methoxycarbonyl-4-oxoazetidine-1-sulfonate |
|---|---|
| PubChem CID | 88628537 |
| Molecular Formula | C16H21ClN4NaO11PS2 |
| Molecular Weight | 598.91 g/mol |
| Exact Mass | 598.00 |
| IUPAC Name | sodium (2R,3R)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-diethoxyphosphorylacetyl]amino]-2-methoxycarbonyl-4-oxoazetidine-1-sulfonate |
| SMILES | CCOP(=O)(OCC)C(C(=O)N[C@H]1C(=O)N(S(=O)(=O)[O-])[C@H]1C(=O)OC)c1csc(NC(=O)CCl)n1.[Na+] |
| InChI | InChI=1S/C16H22ClN4O11PS2.Na/c1-4-31-33(26,32-5-2)12(8-7-34-16(18-8)19-9(22)6-17)13(23)20-10-11(15(25)30-3)21(14(10)24)35(27,28)29;/h7,10-12H,4-6H2,1-3H3,(H,20,23)(H,18,19,22)(H,27,28,29);/q;+1/p-1/t10-,11-,12?;/m1./s1 |
| InChIKey | PRNVLPAFVSAFBH-XNXIJHLMSA-M |
| XLogP | -3.04 |
| TPSA | 210.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.91 |
| LogP ≤ 5 | -3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|