C13H13Cl2N5O9S2 — CID 88628840
(2R,3R)-3-[[(2Z)-2-[5-chloro-2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-2-methoxycarbonyl-4-oxoazetidine-1-sulfonic acid (PubChem CID 88628840) has the molecular formula C13H13Cl2N5O9S2 and a molecular weight of 518.31 g/mol. Its IUPAC name is (2R,3R)-3-[[(2Z)-2-[5-chloro-2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-2-methoxycarbonyl-4-oxoazetidine-1-sulfonic acid.
| Compound Name | (2R,3R)-3-[[(2Z)-2-[5-chloro-2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-2-methoxycarbonyl-4-oxoazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 88628840 |
| Molecular Formula | C13H13Cl2N5O9S2 |
| Molecular Weight | 518.31 g/mol |
| Exact Mass | 516.95 |
| IUPAC Name | (2R,3R)-3-[[(2Z)-2-[5-chloro-2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-2-methoxycarbonyl-4-oxoazetidine-1-sulfonic acid |
| SMILES | CO/N=C(\C(=O)N[C@H]1C(=O)N(S(=O)(=O)O)[C@H]1C(=O)OC)c1nc(NC(=O)CCl)sc1Cl |
| InChI | InChI=1S/C13H13Cl2N5O9S2/c1-28-12(24)8-7(11(23)20(8)31(25,26)27)17-10(22)6(19-29-2)5-9(15)30-13(18-5)16-4(21)3-14/h7-8H,3H2,1-2H3,(H,17,22)(H,16,18,21)(H,25,26,27)/b19-6-/t7-,8-/m1/s1 |
| InChIKey | OSVFQVCLZZYIJB-BGZWOBEBSA-N |
| XLogP | -1.00 |
| TPSA | 193.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.31 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|