C19H18ClN5O9S2 — CID 88629243
(2R,3R)-3-[[(2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-phenylmethoxyiminoacetyl]amino]-2-methoxycarbonyl-4-oxoazetidine-1-sulfonic acid (PubChem CID 88629243) has the molecular formula C19H18ClN5O9S2 and a molecular weight of 559.97 g/mol. Its IUPAC name is (2R,3R)-3-[[(2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-phenylmethoxyiminoacetyl]amino]-2-methoxycarbonyl-4-oxoazetidine-1-sulfonic acid.
| Compound Name | (2R,3R)-3-[[(2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-phenylmethoxyiminoacetyl]amino]-2-methoxycarbonyl-4-oxoazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 88629243 |
| Molecular Formula | C19H18ClN5O9S2 |
| Molecular Weight | 559.97 g/mol |
| Exact Mass | 559.02 |
| IUPAC Name | (2R,3R)-3-[[(2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-phenylmethoxyiminoacetyl]amino]-2-methoxycarbonyl-4-oxoazetidine-1-sulfonic acid |
| SMILES | COC(=O)[C@H]1[C@@H](NC(=O)/C(=N\OCc2ccccc2)c2csc(NC(=O)CCl)n2)C(=O)N1S(=O)(=O)O |
| InChI | InChI=1S/C19H18ClN5O9S2/c1-33-18(29)15-14(17(28)25(15)36(30,31)32)23-16(27)13(24-34-8-10-5-3-2-4-6-10)11-9-35-19(21-11)22-12(26)7-20/h2-6,9,14-15H,7-8H2,1H3,(H,23,27)(H,21,22,26)(H,30,31,32)/b24-13-/t14-,15-/m1/s1 |
| InChIKey | AWAABVKHDAUHLM-KAHLMOIESA-N |
| XLogP | -0.09 |
| TPSA | 193.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.97 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|