C16H18ClN5O11S2 — CID 88628288
(2R,3R)-3-[[(2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-2-(2-ethoxy-2-oxoethoxy)carbonyl-4-oxoazetidine-1-sulfonic acid (PubChem CID 88628288) has the molecular formula C16H18ClN5O11S2 and a molecular weight of 555.93 g/mol. Its IUPAC name is (2R,3R)-3-[[(2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-2-(2-ethoxy-2-oxoethoxy)carbonyl-4-oxoazetidine-1-sulfonic acid.
| Compound Name | (2R,3R)-3-[[(2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-2-(2-ethoxy-2-oxoethoxy)carbonyl-4-oxoazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 88628288 |
| Molecular Formula | C16H18ClN5O11S2 |
| Molecular Weight | 555.93 g/mol |
| Exact Mass | 555.01 |
| IUPAC Name | (2R,3R)-3-[[(2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-2-(2-ethoxy-2-oxoethoxy)carbonyl-4-oxoazetidine-1-sulfonic acid |
| SMILES | CCOC(=O)COC(=O)[C@H]1[C@@H](NC(=O)/C(=N\OC)c2csc(NC(=O)CCl)n2)C(=O)N1S(=O)(=O)O |
| InChI | InChI=1S/C16H18ClN5O11S2/c1-3-32-9(24)5-33-15(27)12-11(14(26)22(12)35(28,29)30)20-13(25)10(21-31-2)7-6-34-16(18-7)19-8(23)4-17/h6,11-12H,3-5H2,1-2H3,(H,20,25)(H,18,19,23)(H,28,29,30)/b21-10-/t11-,12-/m1/s1 |
| InChIKey | POHKTLCEYKZIDI-SIVVQIQWSA-N |
| XLogP | -1.72 |
| TPSA | 219.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.93 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|