C14H16N5NaO10S2 — CID 173396411
sodium (2S,3S)-3-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-(2-ethoxy-2-oxoethoxy)carbonyl-4-oxoazetidine-1-sulfonate (PubChem CID 173396411) has the molecular formula C14H16N5NaO10S2 and a molecular weight of 501.43 g/mol. Its IUPAC name is sodium (2S,3S)-3-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-(2-ethoxy-2-oxoethoxy)carbonyl-4-oxoazetidine-1-sulfonate.
| Compound Name | sodium (2S,3S)-3-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-(2-ethoxy-2-oxoethoxy)carbonyl-4-oxoazetidine-1-sulfonate |
|---|---|
| PubChem CID | 173396411 |
| Molecular Formula | C14H16N5NaO10S2 |
| Molecular Weight | 501.43 g/mol |
| Exact Mass | 501.02 |
| IUPAC Name | sodium (2S,3S)-3-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-(2-ethoxy-2-oxoethoxy)carbonyl-4-oxoazetidine-1-sulfonate |
| SMILES | CCOC(=O)COC(=O)[C@@H]1[C@H](NC(=O)C(=NOC)c2csc(N)n2)C(=O)N1S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C14H17N5O10S2.Na/c1-3-28-7(20)4-29-13(23)10-9(12(22)19(10)31(24,25)26)17-11(21)8(18-27-2)6-5-30-14(15)16-6;/h5,9-10H,3-4H2,1-2H3,(H2,15,16)(H,17,21)(H,24,25,26);/q;+1/p-1/t9-,10-;/m0./s1 |
| InChIKey | AFNWIVMHLLCKDA-IYPAPVHQSA-M |
| XLogP | -5.66 |
| TPSA | 219.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.43 |
| LogP ≤ 5 | -5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|