C12H15N6NaO7S3 — CID 74088533
sodium 3-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-(2-formamidoethylsulfanyl)-4-oxoazetidine-1-sulfonate (PubChem CID 74088533) has the molecular formula C12H15N6NaO7S3 and a molecular weight of 474.48 g/mol. Its IUPAC name is sodium 3-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-(2-formamidoethylsulfanyl)-4-oxoazetidine-1-sulfonate.
| Compound Name | sodium 3-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-(2-formamidoethylsulfanyl)-4-oxoazetidine-1-sulfonate |
|---|---|
| PubChem CID | 74088533 |
| Molecular Formula | C12H15N6NaO7S3 |
| Molecular Weight | 474.48 g/mol |
| Exact Mass | 474.01 |
| IUPAC Name | sodium 3-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-(2-formamidoethylsulfanyl)-4-oxoazetidine-1-sulfonate |
| SMILES | CON=C(C(=O)NC1C(=O)N(S(=O)(=O)[O-])C1SCCNC=O)c1csc(N)n1.[Na+] |
| InChI | InChI=1S/C12H16N6O7S3.Na/c1-25-17-7(6-4-27-12(13)15-6)9(20)16-8-10(21)18(28(22,23)24)11(8)26-3-2-14-5-19;/h4-5,8,11H,2-3H2,1H3,(H2,13,15)(H,14,19)(H,16,20)(H,22,23,24);/q;+1/p-1 |
| InChIKey | ZLANCAJLMUGAIK-UHFFFAOYSA-M |
| XLogP | -5.33 |
| TPSA | 196.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.48 |
| LogP ≤ 5 | -5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|