C14H16ClN5O9S2 — CID 88629176
2-(acetyloxymethyl)-3-[[(2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidine-1-sulfonic acid (PubChem CID 88629176) has the molecular formula C14H16ClN5O9S2 and a molecular weight of 497.90 g/mol. Its IUPAC name is 2-(acetyloxymethyl)-3-[[(2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidine-1-sulfonic acid.
| Compound Name | 2-(acetyloxymethyl)-3-[[(2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 88629176 |
| Molecular Formula | C14H16ClN5O9S2 |
| Molecular Weight | 497.90 g/mol |
| Exact Mass | 497.01 |
| IUPAC Name | 2-(acetyloxymethyl)-3-[[(2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidine-1-sulfonic acid |
| SMILES | CO/N=C(\C(=O)NC1C(=O)N(S(=O)(=O)O)C1COC(C)=O)c1csc(NC(=O)CCl)n1 |
| InChI | InChI=1S/C14H16ClN5O9S2/c1-6(21)29-4-8-11(13(24)20(8)31(25,26)27)18-12(23)10(19-28-2)7-5-30-14(16-7)17-9(22)3-15/h5,8,11H,3-4H2,1-2H3,(H,18,23)(H,16,17,22)(H,25,26,27)/b19-10- |
| InChIKey | RHSJSJQQCIAJDR-GRSHGNNSSA-N |
| XLogP | -1.27 |
| TPSA | 193.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.90 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|