C12H12Cl2N5NaO7S2 — CID 173396583
sodium (2S,3S)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-2-(chloromethyl)-4-oxoazetidine-1-sulfonate (PubChem CID 173396583) has the molecular formula C12H12Cl2N5NaO7S2 and a molecular weight of 496.29 g/mol. Its IUPAC name is sodium (2S,3S)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-2-(chloromethyl)-4-oxoazetidine-1-sulfonate.
| Compound Name | sodium (2S,3S)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-2-(chloromethyl)-4-oxoazetidine-1-sulfonate |
|---|---|
| PubChem CID | 173396583 |
| Molecular Formula | C12H12Cl2N5NaO7S2 |
| Molecular Weight | 496.29 g/mol |
| Exact Mass | 494.95 |
| IUPAC Name | sodium (2S,3S)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-2-(chloromethyl)-4-oxoazetidine-1-sulfonate |
| SMILES | CON=C(C(=O)N[C@@H]1C(=O)N(S(=O)(=O)[O-])[C@@H]1CCl)c1csc(NC(=O)CCl)n1.[Na+] |
| InChI | InChI=1S/C12H13Cl2N5O7S2.Na/c1-26-18-8(5-4-27-12(15-5)16-7(20)3-14)10(21)17-9-6(2-13)19(11(9)22)28(23,24)25;/h4,6,9H,2-3H2,1H3,(H,17,21)(H,15,16,20)(H,23,24,25);/q;+1/p-1/t6-,9+;/m1./s1 |
| InChIKey | QBYAUIFYTAHPHK-VNUWRVCDSA-M |
| XLogP | -3.93 |
| TPSA | 170.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.29 |
| LogP ≤ 5 | -3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|