C12H14ClN5O5S — CID 173420867
2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-N-[(2R,3S)-2-hydroxy-1-methyl-4-oxoazetidin-3-yl]-2-methoxyiminoacetamide (PubChem CID 173420867) has the molecular formula C12H14ClN5O5S and a molecular weight of 375.79 g/mol. Its IUPAC name is 2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-N-[(2R,3S)-2-hydroxy-1-methyl-4-oxoazetidin-3-yl]-2-methoxyiminoacetamide.
| Compound Name | 2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-N-[(2R,3S)-2-hydroxy-1-methyl-4-oxoazetidin-3-yl]-2-methoxyiminoacetamide |
|---|---|
| PubChem CID | 173420867 |
| Molecular Formula | C12H14ClN5O5S |
| Molecular Weight | 375.79 g/mol |
| Exact Mass | 375.04 |
| IUPAC Name | 2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-N-[(2R,3S)-2-hydroxy-1-methyl-4-oxoazetidin-3-yl]-2-methoxyiminoacetamide |
| SMILES | CON=C(C(=O)N[C@@H]1C(=O)N(C)[C@@H]1O)c1csc(NC(=O)CCl)n1 |
| InChI | InChI=1S/C12H14ClN5O5S/c1-18-10(21)8(11(18)22)16-9(20)7(17-23-2)5-4-24-12(14-5)15-6(19)3-13/h4,8,10,21H,3H2,1-2H3,(H,16,20)(H,14,15,19)/t8-,10+/m0/s1 |
| InChIKey | VTINELOWHNTGNW-WCBMZHEXSA-N |
| XLogP | -1.05 |
| TPSA | 133.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.79 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|