C14H16ClN5O6S — CID 54348552
methyl 2-[(2S,3R)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidin-2-yl]acetate (PubChem CID 54348552) has the molecular formula C14H16ClN5O6S and a molecular weight of 417.83 g/mol. Its IUPAC name is methyl 2-[(2S,3R)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidin-2-yl]acetate.
| Compound Name | methyl 2-[(2S,3R)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidin-2-yl]acetate |
|---|---|
| PubChem CID | 54348552 |
| Molecular Formula | C14H16ClN5O6S |
| Molecular Weight | 417.83 g/mol |
| Exact Mass | 417.05 |
| IUPAC Name | methyl 2-[(2S,3R)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidin-2-yl]acetate |
| SMILES | CON=C(C(=O)N[C@H]1C(=O)N[C@H]1CC(=O)OC)c1csc(NC(=O)CCl)n1 |
| InChI | InChI=1S/C14H16ClN5O6S/c1-25-9(22)3-6-10(12(23)16-6)19-13(24)11(20-26-2)7-5-27-14(17-7)18-8(21)4-15/h5-6,10H,3-4H2,1-2H3,(H,16,23)(H,19,24)(H,17,18,21)/t6-,10+/m0/s1 |
| InChIKey | UEANFLFICLOLKW-QUBYGPBYSA-N |
| XLogP | -0.78 |
| TPSA | 148.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.83 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|